About tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate
tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate (PubChem CID 8500981) has the molecular formula C11H14ClFN2O4S
and a molecular weight of 324.76 g/mol. Its IUPAC name is tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate |
| PubChem CID | 8500981 |
| Molecular Formula | C11H14ClFN2O4S |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNS(=O)(=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C11H14ClFN2O4S/c1-11(2,3)19-10(16)14-15-20(17,18)9-5-4-7(12)6-8(9)13/h4-6,15H,1-3H3,(H,14,16) |
| InChIKey | VHBPHGDYRWEUHQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate?
The IUPAC name of tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate (CID 8500981) is tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate.
What is the SMILES notation for tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate?
The canonical SMILES for tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate is CC(C)(C)OC(=O)NNS(=O)(=O)c1ccc(Cl)cc1F.
What is the InChIKey of tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate?
The InChIKey is VHBPHGDYRWEUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClFN2O4S/c1-11(2,3)19-10(16)14-15-20(17,18)9-5-4-7(12)6-8(9)13/h4-6,15H,1-3H3,(H,14,16).
What are the key properties of tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate?
tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate has a molecular weight of 324.76 g/mol, XLogP of 2.20, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(4-chloro-2-fluorophenyl)sulfonylamino]carbamate is sourced from PubChem (CID 8500981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).