C9H12FNO3S — CID 850123
4-fluoro-3-methoxy-N,N-dimethylbenzenesulfonamide (PubChem CID 850123) has the molecular formula C9H12FNO3S and a molecular weight of 233.26 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-fluoro-3-methoxy-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 850123 |
| Molecular Formula | C9H12FNO3S |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | 4-fluoro-3-methoxy-N,N-dimethylbenzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)N(C)C)ccc1F |
| InChI | InChI=1S/C9H12FNO3S/c1-11(2)15(12,13)7-4-5-8(10)9(6-7)14-3/h4-6H,1-3H3 |
| InChIKey | UTUKHBAKZVZBRM-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |