C18H17N3OS — CID 8501451
4-cyano-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide (PubChem CID 8501451) has the molecular formula C18H17N3OS and a molecular weight of 323.42 g/mol. Its IUPAC name is 4-cyano-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 4-cyano-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 8501451 |
| Molecular Formula | C18H17N3OS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-cyano-N-prop-2-enyl-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)benzamide |
| SMILES | C=CCN(C(=O)c1ccc(C#N)cc1)c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C18H17N3OS/c1-2-11-21(17(22)14-9-7-13(12-19)8-10-14)18-20-15-5-3-4-6-16(15)23-18/h2,7-10H,1,3-6,11H2 |
| InChIKey | RGUGKIDTSYYMLB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|