C7HCl2N3 — CID 850221
2,6-dichloropyridine-3,5-dicarbonitrile (PubChem CID 850221) has the molecular formula C7HCl2N3 and a molecular weight of 198.01 g/mol. Its IUPAC name is 2,6-dichloropyridine-3,5-dicarbonitrile.
| Compound Name | 2,6-dichloropyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 850221 |
| Molecular Formula | C7HCl2N3 |
| Molecular Weight | 198.01 g/mol |
| Exact Mass | 196.95 |
| IUPAC Name | 2,6-dichloropyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(Cl)nc1Cl |
| InChI | InChI=1S/C7HCl2N3/c8-6-4(2-10)1-5(3-11)7(9)12-6/h1H |
| InChIKey | JWVLIQKMDXWUFT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.01 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|