C17H21NO3 — CID 8502430
(5-methoxy-3-methyl-1-benzofuran-2-yl)-[(2R)-2-methylpiperidin-1-yl]methanone (PubChem CID 8502430) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (5-methoxy-3-methyl-1-benzofuran-2-yl)-[(2R)-2-methylpiperidin-1-yl]methanone.
| Compound Name | (5-methoxy-3-methyl-1-benzofuran-2-yl)-[(2R)-2-methylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 8502430 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (5-methoxy-3-methyl-1-benzofuran-2-yl)-[(2R)-2-methylpiperidin-1-yl]methanone |
| SMILES | COc1ccc2oc(C(=O)N3CCCC[C@H]3C)c(C)c2c1 |
| InChI | InChI=1S/C17H21NO3/c1-11-6-4-5-9-18(11)17(19)16-12(2)14-10-13(20-3)7-8-15(14)21-16/h7-8,10-11H,4-6,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | BRSOCTTXHYYIAL-LLVKDONJSA-N |
| XLogP | 3.76 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |