C15H13N5OS — CID 850294
5-methyl-4-[3-[(2-methylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,2-oxazole (PubChem CID 850294) has the molecular formula C15H13N5OS and a molecular weight of 311.37 g/mol. Its IUPAC name is 5-methyl-4-[3-[(2-methylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,2-oxazole.
| Compound Name | 5-methyl-4-[3-[(2-methylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 850294 |
| Molecular Formula | C15H13N5OS |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 5-methyl-4-[3-[(2-methylphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-1,2-oxazole |
| SMILES | Cc1ccccc1Cc1nnc2sc(-c3cnoc3C)nn12 |
| InChI | InChI=1S/C15H13N5OS/c1-9-5-3-4-6-11(9)7-13-17-18-15-20(13)19-14(22-15)12-8-16-21-10(12)2/h3-6,8H,7H2,1-2H3 |
| InChIKey | VIMQZAGUTJLXKJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |