C18H30O4 — CID 85040251
2-(2,4-dihydroxy-3,5-dimethylnon-7-enyl)-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 85040251) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 2-(2,4-dihydroxy-3,5-dimethylnon-7-enyl)-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | 2-(2,4-dihydroxy-3,5-dimethylnon-7-enyl)-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 85040251 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 2-(2,4-dihydroxy-3,5-dimethylnon-7-enyl)-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CC=CCC(C)C(O)C(C)C(O)CC1OC(=O)C=CC1CC |
| InChI | InChI=1S/C18H30O4/c1-5-7-8-12(3)18(21)13(4)15(19)11-16-14(6-2)9-10-17(20)22-16/h5,7,9-10,12-16,18-19,21H,6,8,11H2,1-4H3 |
| InChIKey | DGTXWIIFBBXJAA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|