About 2-chloro-1,3,3-triethoxyprop-1-ene
2-chloro-1,3,3-triethoxyprop-1-ene (PubChem CID 85044404) has the molecular formula C9H17ClO3
and a molecular weight of 208.68 g/mol. Its IUPAC name is 2-chloro-1,3,3-triethoxyprop-1-ene.
Molecular Properties
| Compound Name | 2-chloro-1,3,3-triethoxyprop-1-ene |
| PubChem CID | 85044404 |
| Molecular Formula | C9H17ClO3 |
| Molecular Weight | 208.68 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-chloro-1,3,3-triethoxyprop-1-ene |
| SMILES | CCOC=C(Cl)C(OCC)OCC |
| InChI | InChI=1S/C9H17ClO3/c1-4-11-7-8(10)9(12-5-2)13-6-3/h7,9H,4-6H2,1-3H3 |
| InChIKey | VPXOIXIBQNYQPM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.68 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-1,3,3-triethoxyprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-1,3,3-triethoxyprop-1-ene?
The IUPAC name of 2-chloro-1,3,3-triethoxyprop-1-ene (CID 85044404) is 2-chloro-1,3,3-triethoxyprop-1-ene.
What is the SMILES notation for 2-chloro-1,3,3-triethoxyprop-1-ene?
The canonical SMILES for 2-chloro-1,3,3-triethoxyprop-1-ene is CCOC=C(Cl)C(OCC)OCC.
What is the InChIKey of 2-chloro-1,3,3-triethoxyprop-1-ene?
The InChIKey is VPXOIXIBQNYQPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClO3/c1-4-11-7-8(10)9(12-5-2)13-6-3/h7,9H,4-6H2,1-3H3.
What are the key properties of 2-chloro-1,3,3-triethoxyprop-1-ene?
2-chloro-1,3,3-triethoxyprop-1-ene has a molecular weight of 208.68 g/mol, XLogP of 2.50, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-1,3,3-triethoxyprop-1-ene is sourced from PubChem (CID 85044404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).