About 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride
2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride (PubChem CID 85044432) has the molecular formula C7H16Cl2N2O2
and a molecular weight of 231.12 g/mol. Its IUPAC name is 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride.
Molecular Properties
| Compound Name | 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride |
| PubChem CID | 85044432 |
| Molecular Formula | C7H16Cl2N2O2 |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride |
| SMILES | CC(N)(C=CCCN)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C7H14N2O2.2ClH/c1-7(9,6(10)11)4-2-3-5-8;;/h2,4H,3,5,8-9H2,1H3,(H,10,11);2*1H |
| InChIKey | GVOHSFUCSZWPFD-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride?
The IUPAC name of 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride (CID 85044432) is 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride.
What is the SMILES notation for 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride?
The canonical SMILES for 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride is CC(N)(C=CCCN)C(=O)O.Cl.Cl.
What is the InChIKey of 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride?
The InChIKey is GVOHSFUCSZWPFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2.2ClH/c1-7(9,6(10)11)4-2-3-5-8;;/h2,4H,3,5,8-9H2,1H3,(H,10,11);2*1H.
What are the key properties of 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride?
2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride has a molecular weight of 231.12 g/mol, XLogP of 0.54, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diamino-2-methylhex-3-enoic acid;dihydrochloride is sourced from PubChem (CID 85044432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).