About disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate
disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate (PubChem CID 85044823) has the molecular formula C4H8N3Na2O5P
and a molecular weight of 255.08 g/mol. Its IUPAC name is disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate.
Molecular Properties
| Compound Name | disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate |
| PubChem CID | 85044823 |
| Molecular Formula | C4H8N3Na2O5P |
| Molecular Weight | 255.08 g/mol |
| Exact Mass | 255.00 |
| IUPAC Name | disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate |
| SMILES | CN(CC(=O)[O-])C(N)=NP(=O)([O-])O.[Na+].[Na+] |
| InChI | InChI=1S/C4H10N3O5P.2Na/c1-7(2-3(8)9)4(5)6-13(10,11)12;;/h2H2,1H3,(H,8,9)(H4,5,6,10,11,12);;/q;2*+1/p-2 |
| InChIKey | RNTXMYSPASRLFT-UHFFFAOYSA-L |
| XLogP | -9.55 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.08 |
| LogP ≤ 5 | -9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate?
The IUPAC name of disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate (CID 85044823) is disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate.
What is the SMILES notation for disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate?
The canonical SMILES for disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate is CN(CC(=O)[O-])C(N)=NP(=O)([O-])O.[Na+].[Na+].
What is the InChIKey of disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate?
The InChIKey is RNTXMYSPASRLFT-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H10N3O5P.2Na/c1-7(2-3(8)9)4(5)6-13(10,11)12;;/h2H2,1H3,(H,8,9)(H4,5,6,10,11,12);;/q;2*+1/p-2.
What are the key properties of disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate?
disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate has a molecular weight of 255.08 g/mol, XLogP of -9.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-[[N'-[hydroxy(oxido)phosphoryl]carbamimidoyl]-methylamino]acetate is sourced from PubChem (CID 85044823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).