C24H21NO2S — CID 85045559
2-[methyl-[3-phenyl-5-(4-thiophen-3-ylphenyl)pent-2-en-4-ynyl]amino]acetic acid (PubChem CID 85045559) has the molecular formula C24H21NO2S and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-[methyl-[3-phenyl-5-(4-thiophen-3-ylphenyl)pent-2-en-4-ynyl]amino]acetic acid.
| Compound Name | 2-[methyl-[3-phenyl-5-(4-thiophen-3-ylphenyl)pent-2-en-4-ynyl]amino]acetic acid |
|---|---|
| PubChem CID | 85045559 |
| Molecular Formula | C24H21NO2S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 2-[methyl-[3-phenyl-5-(4-thiophen-3-ylphenyl)pent-2-en-4-ynyl]amino]acetic acid |
| SMILES | CN(CC=C(C#Cc1ccc(-c2ccsc2)cc1)c1ccccc1)CC(=O)O |
| InChI | InChI=1S/C24H21NO2S/c1-25(17-24(26)27)15-13-22(20-5-3-2-4-6-20)12-9-19-7-10-21(11-8-19)23-14-16-28-18-23/h2-8,10-11,13-14,16,18H,15,17H2,1H3,(H,26,27) |
| InChIKey | WOFXCXLLLFRLCB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|