C20H25NO2 — CID 85054802
2-(3-hydroxy-3,7-dimethylocta-1,6-dienyl)-1-methylquinolin-4-one (PubChem CID 85054802) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-(3-hydroxy-3,7-dimethylocta-1,6-dienyl)-1-methylquinolin-4-one.
| Compound Name | 2-(3-hydroxy-3,7-dimethylocta-1,6-dienyl)-1-methylquinolin-4-one |
|---|---|
| PubChem CID | 85054802 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-(3-hydroxy-3,7-dimethylocta-1,6-dienyl)-1-methylquinolin-4-one |
| SMILES | CC(C)=CCCC(C)(O)C=Cc1cc(=O)c2ccccc2n1C |
| InChI | InChI=1S/C20H25NO2/c1-15(2)8-7-12-20(3,23)13-11-16-14-19(22)17-9-5-6-10-18(17)21(16)4/h5-6,8-11,13-14,23H,7,12H2,1-4H3 |
| InChIKey | VUAZVPWKLXTCMY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|