C31H56O9 — CID 85056859
2,3,5-trihydroxy-4-(13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoyl)oxypentanoic acid (PubChem CID 85056859) has the molecular formula C31H56O9 and a molecular weight of 572.78 g/mol. Its IUPAC name is 2,3,5-trihydroxy-4-(13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoyl)oxypentanoic acid.
| Compound Name | 2,3,5-trihydroxy-4-(13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoyl)oxypentanoic acid |
|---|---|
| PubChem CID | 85056859 |
| Molecular Formula | C31H56O9 |
| Molecular Weight | 572.78 g/mol |
| Exact Mass | 572.39 |
| IUPAC Name | 2,3,5-trihydroxy-4-(13-hydroxy-2,4,6,8-tetramethyl-3-oxodocos-4-enoyl)oxypentanoic acid |
| SMILES | CCCCCCCCCC(O)CCCCC(C)CC(C)C=C(C)C(=O)C(C)C(=O)OC(CO)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C31H56O9/c1-6-7-8-9-10-11-12-16-25(33)17-14-13-15-21(2)18-22(3)19-23(4)27(34)24(5)31(39)40-26(20-32)28(35)29(36)30(37)38/h19,21-22,24-26,28-29,32-33,35-36H,6-18,20H2,1-5H3,(H,37,38) |
| InChIKey | UUQBKUDQQXPGGI-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.78 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|