C44H74O10 — CID 85057795
22-ethyl-7,9,11,15-tetrahydroxy-6'-(2-hydroxypropyl)-5',6,8,10,14,16,28,29-octamethylspiro[2,26-dioxabicyclo[23.3.1]nonacosa-4,18,20-triene-27,2'-oxane]-3,13-dione (PubChem CID 85057795) has the molecular formula C44H74O10 and a molecular weight of 763.07 g/mol. Its IUPAC name is 22-ethyl-7,9,11,15-tetrahydroxy-6'-(2-hydroxypropyl)-5',6,8,10,14,16,28,29-octamethylspiro[2,26-dioxabicyclo[23.3.1]nonacosa-4,18,20-triene-27,2'-oxane]-3,13-dione.
| Compound Name | 22-ethyl-7,9,11,15-tetrahydroxy-6'-(2-hydroxypropyl)-5',6,8,10,14,16,28,29-octamethylspiro[2,26-dioxabicyclo[23.3.1]nonacosa-4,18,20-triene-27,2'-oxane]-3,13-dione |
|---|---|
| PubChem CID | 85057795 |
| Molecular Formula | C44H74O10 |
| Molecular Weight | 763.07 g/mol |
| Exact Mass | 762.53 |
| IUPAC Name | 22-ethyl-7,9,11,15-tetrahydroxy-6'-(2-hydroxypropyl)-5',6,8,10,14,16,28,29-octamethylspiro[2,26-dioxabicyclo[23.3.1]nonacosa-4,18,20-triene-27,2'-oxane]-3,13-dione |
| SMILES | CCC1C=CC=CCC(C)C(O)C(C)C(=O)CC(O)C(C)C(O)C(C)C(O)C(C)C=CC(=O)OC2C(C)C(CC1)OC1(CCC(C)C(CC(C)O)O1)C2C |
| InChI | InChI=1S/C44H74O10/c1-11-34-16-14-12-13-15-26(3)40(49)29(6)35(46)24-36(47)30(7)42(51)32(9)41(50)27(4)17-20-39(48)52-43-31(8)37(19-18-34)53-44(33(43)10)22-21-25(2)38(54-44)23-28(5)45/h12-14,16-17,20,25-34,36-38,40-43,45,47,49-51H,11,15,18-19,21-24H2,1-10H3 |
| InChIKey | MAWWFIBHIOEUPH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 162.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.07 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |