C42H67NO12 — CID 85057840
16-ethyl-1,13-dihydroxy-11-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-22,24-dimethoxy-12,18,20,26-tetramethyl-10,27-dioxa-4-azatricyclo[21.3.1.04,8]heptacos-17-ene-2,3,9,15-tetrone (PubChem CID 85057840) has the molecular formula C42H67NO12 and a molecular weight of 777.99 g/mol. Its IUPAC name is 16-ethyl-1,13-dihydroxy-11-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-22,24-dimethoxy-12,18,20,26-tetramethyl-10,27-dioxa-4-azatricyclo[21.3.1.04,8]heptacos-17-ene-2,3,9,15-tetrone.
| Compound Name | 16-ethyl-1,13-dihydroxy-11-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-22,24-dimethoxy-12,18,20,26-tetramethyl-10,27-dioxa-4-azatricyclo[21.3.1.04,8]heptacos-17-ene-2,3,9,15-tetrone |
|---|---|
| PubChem CID | 85057840 |
| Molecular Formula | C42H67NO12 |
| Molecular Weight | 777.99 g/mol |
| Exact Mass | 777.47 |
| IUPAC Name | 16-ethyl-1,13-dihydroxy-11-[1-(4-hydroxy-3-methoxycyclohexyl)prop-1-en-2-yl]-22,24-dimethoxy-12,18,20,26-tetramethyl-10,27-dioxa-4-azatricyclo[21.3.1.04,8]heptacos-17-ene-2,3,9,15-tetrone |
| SMILES | CCC1C=C(C)CC(C)CC(OC)C2OC(O)(C(=O)C(=O)N3CCCC3C(=O)OC(C(C)=CC3CCC(O)C(OC)C3)C(C)C(O)CC1=O)C(C)CC2OC |
| InChI | InChI=1S/C42H67NO12/c1-10-29-17-23(2)16-24(3)18-35(52-8)38-36(53-9)20-26(5)42(50,55-38)39(47)40(48)43-15-11-12-30(43)41(49)54-37(27(6)32(45)22-33(29)46)25(4)19-28-13-14-31(44)34(21-28)51-7/h17,19,24,26-32,34-38,44-45,50H,10-16,18,20-22H2,1-9H3 |
| InChIKey | NHXWKQVTFLWDLA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 178.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.99 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|