C13H13BrN2O4S2 — CID 8505825
N'-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenoxy)acetohydrazide (PubChem CID 8505825) has the molecular formula C13H13BrN2O4S2 and a molecular weight of 405.30 g/mol. Its IUPAC name is N'-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenoxy)acetohydrazide.
| Compound Name | N'-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenoxy)acetohydrazide |
|---|---|
| PubChem CID | 8505825 |
| Molecular Formula | C13H13BrN2O4S2 |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 403.95 |
| IUPAC Name | N'-(5-bromothiophen-2-yl)sulfonyl-2-(3-methylphenoxy)acetohydrazide |
| SMILES | Cc1cccc(OCC(=O)NNS(=O)(=O)c2ccc(Br)s2)c1 |
| InChI | InChI=1S/C13H13BrN2O4S2/c1-9-3-2-4-10(7-9)20-8-12(17)15-16-22(18,19)13-6-5-11(14)21-13/h2-7,16H,8H2,1H3,(H,15,17) |
| InChIKey | JUEQYCULHXZJLO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|