C18H19FN2O4S — CID 8506094
2-(3-fluorophenoxy)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)acetohydrazide (PubChem CID 8506094) has the molecular formula C18H19FN2O4S and a molecular weight of 378.43 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)acetohydrazide.
| Compound Name | 2-(3-fluorophenoxy)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)acetohydrazide |
|---|---|
| PubChem CID | 8506094 |
| Molecular Formula | C18H19FN2O4S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-(3-fluorophenoxy)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)acetohydrazide |
| SMILES | O=C(COc1cccc(F)c1)NNS(=O)(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C18H19FN2O4S/c19-15-6-3-7-16(11-15)25-12-18(22)20-21-26(23,24)17-9-8-13-4-1-2-5-14(13)10-17/h3,6-11,21H,1-2,4-5,12H2,(H,20,22) |
| InChIKey | FTIDWSHEBXHSOL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|