C29H42O6 — CID 85060998
methyl 2-[5-hydroxy-2-(13-hydroxy-3,7,11,15-tetramethyl-12-oxohexadeca-1,6,14-trien-3-yl)oxyphenyl]acetate (PubChem CID 85060998) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is methyl 2-[5-hydroxy-2-(13-hydroxy-3,7,11,15-tetramethyl-12-oxohexadeca-1,6,14-trien-3-yl)oxyphenyl]acetate.
| Compound Name | methyl 2-[5-hydroxy-2-(13-hydroxy-3,7,11,15-tetramethyl-12-oxohexadeca-1,6,14-trien-3-yl)oxyphenyl]acetate |
|---|---|
| PubChem CID | 85060998 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | methyl 2-[5-hydroxy-2-(13-hydroxy-3,7,11,15-tetramethyl-12-oxohexadeca-1,6,14-trien-3-yl)oxyphenyl]acetate |
| SMILES | C=CC(C)(CCC=C(C)CCCC(C)C(=O)C(O)C=C(C)C)Oc1ccc(O)cc1CC(=O)OC |
| InChI | InChI=1S/C29H42O6/c1-8-29(6,35-26-15-14-24(30)18-23(26)19-27(32)34-7)16-10-12-21(4)11-9-13-22(5)28(33)25(31)17-20(2)3/h8,12,14-15,17-18,22,25,30-31H,1,9-11,13,16,19H2,2-7H3 |
| InChIKey | KXTOXZSIGCDGHF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|