C16H13BrFNO3 — CID 85064839
4-[4-(4-bromophenyl)-3-fluorophenyl]-4-hydroxyiminobutanoic acid (PubChem CID 85064839) has the molecular formula C16H13BrFNO3 and a molecular weight of 366.19 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)-3-fluorophenyl]-4-hydroxyiminobutanoic acid.
| Compound Name | 4-[4-(4-bromophenyl)-3-fluorophenyl]-4-hydroxyiminobutanoic acid |
|---|---|
| PubChem CID | 85064839 |
| Molecular Formula | C16H13BrFNO3 |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-[4-(4-bromophenyl)-3-fluorophenyl]-4-hydroxyiminobutanoic acid |
| SMILES | O=C(O)CCC(=NO)c1ccc(-c2ccc(Br)cc2)c(F)c1 |
| InChI | InChI=1S/C16H13BrFNO3/c17-12-4-1-10(2-5-12)13-6-3-11(9-14(13)18)15(19-22)7-8-16(20)21/h1-6,9,22H,7-8H2,(H,20,21) |
| InChIKey | AAKYJCALAWSCOF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|