C44H88N6O — CID 85067269
3-[[N,N'-bis(2-aminoethyl)carbamimidoyl]amino]-N,N-bis(octadec-9-enyl)propanamide (PubChem CID 85067269) has the molecular formula C44H88N6O and a molecular weight of 717.23 g/mol. Its IUPAC name is 3-[[N,N'-bis(2-aminoethyl)carbamimidoyl]amino]-N,N-bis(octadec-9-enyl)propanamide.
| Compound Name | 3-[[N,N'-bis(2-aminoethyl)carbamimidoyl]amino]-N,N-bis(octadec-9-enyl)propanamide |
|---|---|
| PubChem CID | 85067269 |
| Molecular Formula | C44H88N6O |
| Molecular Weight | 717.23 g/mol |
| Exact Mass | 716.70 |
| IUPAC Name | 3-[[N,N'-bis(2-aminoethyl)carbamimidoyl]amino]-N,N-bis(octadec-9-enyl)propanamide |
| SMILES | CCCCCCCCC=CCCCCCCCCN(CCCCCCCCC=CCCCCCCCC)C(=O)CCN/C(=N/CCN)NCCN |
| InChI | InChI=1S/C44H88N6O/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41-50(43(51)35-38-47-44(48-39-36-45)49-40-37-46)42-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-42,45-46H2,1-2H3,(H2,47,48,49) |
| InChIKey | QSVCMEPFMNWFTP-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 108.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.23 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|