C19H25N3O5 — CID 8507059
(5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione (PubChem CID 8507059) has the molecular formula C19H25N3O5 and a molecular weight of 375.43 g/mol. Its IUPAC name is (5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8507059 |
| Molecular Formula | C19H25N3O5 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (5R)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-morpholin-4-yl-2-oxoethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(CC[C@@]2(C)NC(=O)N(CC(=O)N3CCOCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H25N3O5/c1-19(8-7-14-3-5-15(26-2)6-4-14)17(24)22(18(25)20-19)13-16(23)21-9-11-27-12-10-21/h3-6H,7-13H2,1-2H3,(H,20,25)/t19-/m1/s1 |
| InChIKey | QFHMTUBDGBCKDM-LJQANCHMSA-N |
| XLogP | 0.80 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|