C19H31O3P — CID 85074235
1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene (PubChem CID 85074235) has the molecular formula C19H31O3P and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene.
| Compound Name | 1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene |
|---|---|
| PubChem CID | 85074235 |
| Molecular Formula | C19H31O3P |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | 1-diethoxyphosphoryl-3,7,11-trimethyldodeca-1,2,4,6,10-pentaene |
| SMILES | CCOP(=O)(C=C=C(C)C=CC=C(C)CCC=C(C)C)OCC |
| InChI | InChI=1S/C19H31O3P/c1-7-21-23(20,22-8-2)16-15-19(6)14-10-13-18(5)12-9-11-17(3)4/h10-11,13-14,16H,7-9,12H2,1-6H3 |
| InChIKey | XLQBENYOMNVVBB-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|