C26H31FN2O4S — CID 85075431
[2-[2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]cyclohexyl]ethyl]-1,3-dihydroisoindol-5-yl] methanesulfonate (PubChem CID 85075431) has the molecular formula C26H31FN2O4S and a molecular weight of 486.61 g/mol. Its IUPAC name is [2-[2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]cyclohexyl]ethyl]-1,3-dihydroisoindol-5-yl] methanesulfonate.
| Compound Name | [2-[2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]cyclohexyl]ethyl]-1,3-dihydroisoindol-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 85075431 |
| Molecular Formula | C26H31FN2O4S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | [2-[2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]cyclohexyl]ethyl]-1,3-dihydroisoindol-5-yl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2c(c1)CN(CCC1CCC(NC(=O)C=Cc3ccc(F)cc3)CC1)C2 |
| InChI | InChI=1S/C26H31FN2O4S/c1-34(31,32)33-25-12-7-21-17-29(18-22(21)16-25)15-14-20-4-10-24(11-5-20)28-26(30)13-6-19-2-8-23(27)9-3-19/h2-3,6-9,12-13,16,20,24H,4-5,10-11,14-15,17-18H2,1H3,(H,28,30) |
| InChIKey | WUACSCWYLJHDBV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|