C16H18ClN3O3 — CID 850815
methyl 3-[(4-chloro-1-methyl-3-propylpyrazole-5-carbonyl)amino]benzoate (PubChem CID 850815) has the molecular formula C16H18ClN3O3 and a molecular weight of 335.79 g/mol. Its IUPAC name is methyl 3-[(4-chloro-1-methyl-3-propylpyrazole-5-carbonyl)amino]benzoate.
| Compound Name | methyl 3-[(4-chloro-1-methyl-3-propylpyrazole-5-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 850815 |
| Molecular Formula | C16H18ClN3O3 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | methyl 3-[(4-chloro-1-methyl-3-propylpyrazole-5-carbonyl)amino]benzoate |
| SMILES | CCCc1nn(C)c(C(=O)Nc2cccc(C(=O)OC)c2)c1Cl |
| InChI | InChI=1S/C16H18ClN3O3/c1-4-6-12-13(17)14(20(2)19-12)15(21)18-11-8-5-7-10(9-11)16(22)23-3/h5,7-9H,4,6H2,1-3H3,(H,18,21) |
| InChIKey | QJYHDPIEPFITMK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |