C10H8FN3OS — CID 850831
N-(2-fluorophenyl)-4-methylthiadiazole-5-carboxamide (PubChem CID 850831) has the molecular formula C10H8FN3OS and a molecular weight of 237.26 g/mol. Its IUPAC name is N-(2-fluorophenyl)-4-methylthiadiazole-5-carboxamide.
| Compound Name | N-(2-fluorophenyl)-4-methylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 850831 |
| Molecular Formula | C10H8FN3OS |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | N-(2-fluorophenyl)-4-methylthiadiazole-5-carboxamide |
| SMILES | Cc1nnsc1C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C10H8FN3OS/c1-6-9(16-14-13-6)10(15)12-8-5-3-2-4-7(8)11/h2-5H,1H3,(H,12,15) |
| InChIKey | TVZSRIACTAYVQV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |