C15H27N7O3 — CID 85087630
N-[2-[[(4-amino-6-propan-2-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide (PubChem CID 85087630) has the molecular formula C15H27N7O3 and a molecular weight of 353.43 g/mol. Its IUPAC name is N-[2-[[(4-amino-6-propan-2-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide.
| Compound Name | N-[2-[[(4-amino-6-propan-2-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
|---|---|
| PubChem CID | 85087630 |
| Molecular Formula | C15H27N7O3 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | N-[2-[[(4-amino-6-propan-2-yl-1,3,5-triazin-2-yl)amino]carbamoyl]heptyl]-N-hydroxyformamide |
| SMILES | CCCCCC(CN(O)C=O)C(=O)NNc1nc(N)nc(C(C)C)n1 |
| InChI | InChI=1S/C15H27N7O3/c1-4-5-6-7-11(8-22(25)9-23)13(24)20-21-15-18-12(10(2)3)17-14(16)19-15/h9-11,25H,4-8H2,1-3H3,(H,20,24)(H3,16,17,18,19,21) |
| InChIKey | VJAIJJWXVJWGAQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 146.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|