C16H14F3NO4S — CID 85087969
[[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate (PubChem CID 85087969) has the molecular formula C16H14F3NO4S and a molecular weight of 373.35 g/mol. Its IUPAC name is [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 85087969 |
| Molecular Formula | C16H14F3NO4S |
| Molecular Weight | 373.35 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | [[2,2,2-trifluoro-1-(4-methoxyphenyl)ethylidene]amino] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(=NOS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H14F3NO4S/c1-11-3-9-14(10-4-11)25(21,22)24-20-15(16(17,18)19)12-5-7-13(23-2)8-6-12/h3-10H,1-2H3 |
| InChIKey | ARGICORFGIJBDZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|