C24H30O10 — CID 85089588
[2-(6-acetyloxy-1,3,4,9-tetrahydroxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)-3-hydroxypropyl] acetate (PubChem CID 85089588) has the molecular formula C24H30O10 and a molecular weight of 478.49 g/mol. Its IUPAC name is [2-(6-acetyloxy-1,3,4,9-tetrahydroxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)-3-hydroxypropyl] acetate.
| Compound Name | [2-(6-acetyloxy-1,3,4,9-tetrahydroxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)-3-hydroxypropyl] acetate |
|---|---|
| PubChem CID | 85089588 |
| Molecular Formula | C24H30O10 |
| Molecular Weight | 478.49 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [2-(6-acetyloxy-1,3,4,9-tetrahydroxy-4b,8,8-trimethyl-10-oxo-6,7-dihydro-5H-phenanthren-2-yl)-3-hydroxypropyl] acetate |
| SMILES | CC(=O)OCC(CO)c1c(O)c(O)c2c(c1O)C(=O)C(O)=C1C(C)(C)CC(OC(C)=O)CC12C |
| InChI | InChI=1S/C24H30O10/c1-10(26)33-9-12(8-25)14-17(28)15-16(20(31)18(14)29)24(5)7-13(34-11(2)27)6-23(3,4)22(24)21(32)19(15)30/h12-13,25,28-29,31-32H,6-9H2,1-5H3 |
| InChIKey | BLLJRCSMXYBSCC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|