C23H28O4SSe — CID 85089606
(10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate (PubChem CID 85089606) has the molecular formula C23H28O4SSe and a molecular weight of 479.50 g/mol. Its IUPAC name is (10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate.
| Compound Name | (10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 85089606 |
| Molecular Formula | C23H28O4SSe |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | (10,10-dimethyl-3-phenyl-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl) 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[Se]2(c3ccccc3)CC34CCC(CC3O2)C4(C)C)cc1 |
| InChI | InChI=1S/C23H28O4SSe/c1-17-9-11-19(12-10-17)28(24,25)27-29(20-7-5-4-6-8-20)16-23-14-13-18(22(23,2)3)15-21(23)26-29/h4-12,18,21H,13-16H2,1-3H3 |
| InChIKey | HRHATCSVSHUBKG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|