C26H26ClN3O3 — CID 85090330
3-(3-chloro-4-methoxyphenyl)-2-(cyclohexylmethyl)-10-methylpyrimido[4,5-b]quinoline-4,5-dione (PubChem CID 85090330) has the molecular formula C26H26ClN3O3 and a molecular weight of 463.97 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-2-(cyclohexylmethyl)-10-methylpyrimido[4,5-b]quinoline-4,5-dione.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-2-(cyclohexylmethyl)-10-methylpyrimido[4,5-b]quinoline-4,5-dione |
|---|---|
| PubChem CID | 85090330 |
| Molecular Formula | C26H26ClN3O3 |
| Molecular Weight | 463.97 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-2-(cyclohexylmethyl)-10-methylpyrimido[4,5-b]quinoline-4,5-dione |
| SMILES | COc1ccc(-n2c(CC3CCCCC3)nc3c(c(=O)c4ccccc4n3C)c2=O)cc1Cl |
| InChI | InChI=1S/C26H26ClN3O3/c1-29-20-11-7-6-10-18(20)24(31)23-25(29)28-22(14-16-8-4-3-5-9-16)30(26(23)32)17-12-13-21(33-2)19(27)15-17/h6-7,10-13,15-16H,3-5,8-9,14H2,1-2H3 |
| InChIKey | VSICHSMKPKKHQA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.97 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|