C31H42N4O5 — CID 85090477
benzyl N-[1-[[1-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 85090477) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is benzyl N-[1-[[1-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-[[1-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 85090477 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | benzyl N-[1-[[1-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]-1,2-dioxopentan-3-yl]amino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(NC(=O)C(CC(C)C)NC(=O)OCc1ccccc1)C(=O)C(=O)NCCCN1CCCc2ccccc21 |
| InChI | InChI=1S/C31H42N4O5/c1-4-25(28(36)30(38)32-17-11-19-35-18-10-15-24-14-8-9-16-27(24)35)33-29(37)26(20-22(2)3)34-31(39)40-21-23-12-6-5-7-13-23/h5-9,12-14,16,22,25-26H,4,10-11,15,17-21H2,1-3H3,(H,32,38)(H,33,37)(H,34,39) |
| InChIKey | YVMYGKAQQWIQNK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|