C28H28F4N2O6 — CID 85090607
tert-butyl 4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 85090607) has the molecular formula C28H28F4N2O6 and a molecular weight of 564.53 g/mol. Its IUPAC name is tert-butyl 4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 85090607 |
| Molecular Formula | C28H28F4N2O6 |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | tert-butyl 4-oxo-3-[2-(1-oxoisoquinolin-2-yl)butanoylamino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CCC(C(=O)NC(CC(=O)OC(C)(C)C)C(=O)COc1c(F)c(F)cc(F)c1F)n1ccc2ccccc2c1=O |
| InChI | InChI=1S/C28H28F4N2O6/c1-5-20(34-11-10-15-8-6-7-9-16(15)27(34)38)26(37)33-19(13-22(36)40-28(2,3)4)21(35)14-39-25-23(31)17(29)12-18(30)24(25)32/h6-12,19-20H,5,13-14H2,1-4H3,(H,33,37) |
| InChIKey | AKUFTKQBKGAXBM-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|