C36H59BrO10 — CID 85091513
[4-acetyloxy-1-[5-(2-acetyloxypropan-2-yl)-2-methyloxolan-2-yl]-4-[2-(5-bromo-2,6,6-trimethyloxan-2-yl)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]pentyl] acetate (PubChem CID 85091513) has the molecular formula C36H59BrO10 and a molecular weight of 731.76 g/mol. Its IUPAC name is [4-acetyloxy-1-[5-(2-acetyloxypropan-2-yl)-2-methyloxolan-2-yl]-4-[2-(5-bromo-2,6,6-trimethyloxan-2-yl)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]pentyl] acetate.
| Compound Name | [4-acetyloxy-1-[5-(2-acetyloxypropan-2-yl)-2-methyloxolan-2-yl]-4-[2-(5-bromo-2,6,6-trimethyloxan-2-yl)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]pentyl] acetate |
|---|---|
| PubChem CID | 85091513 |
| Molecular Formula | C36H59BrO10 |
| Molecular Weight | 731.76 g/mol |
| Exact Mass | 730.33 |
| IUPAC Name | [4-acetyloxy-1-[5-(2-acetyloxypropan-2-yl)-2-methyloxolan-2-yl]-4-[2-(5-bromo-2,6,6-trimethyloxan-2-yl)-4a-methyl-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-6-yl]pentyl] acetate |
| SMILES | CC(=O)OC(CCC(C)(OC(C)=O)C1CCC2OC(C3(C)CCC(Br)C(C)(C)O3)CCC2(C)O1)C1(C)CCC(C(C)(C)OC(C)=O)O1 |
| InChI | InChI=1S/C36H59BrO10/c1-22(38)41-28(34(9)19-15-26(45-34)32(6,7)43-23(2)39)16-21-35(10,44-24(3)40)30-13-12-27-33(8,46-30)20-17-29(42-27)36(11)18-14-25(37)31(4,5)47-36/h25-30H,12-21H2,1-11H3 |
| InChIKey | XAJJUEHMJGKPKD-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.76 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|