C20H26N4O3 — CID 85095103
4-(5-acetyl-2-butyl-6-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-4-yl)benzenecarboximidamide (PubChem CID 85095103) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-(5-acetyl-2-butyl-6-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-4-yl)benzenecarboximidamide.
| Compound Name | 4-(5-acetyl-2-butyl-6-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-4-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 85095103 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 4-(5-acetyl-2-butyl-6-methyl-1,3-dioxo-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrol-4-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C2C3C(=O)N(CCCC)C(=O)C3C(C)N2C(C)=O)cc1 |
| InChI | InChI=1S/C20H26N4O3/c1-4-5-10-23-19(26)15-11(2)24(12(3)25)17(16(15)20(23)27)13-6-8-14(9-7-13)18(21)22/h6-9,11,15-17H,4-5,10H2,1-3H3,(H3,21,22) |
| InChIKey | AXRPBLMAKIRUKV-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|