C27H48O3Si — CID 85096383
methyl 20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoate (PubChem CID 85096383) has the molecular formula C27H48O3Si and a molecular weight of 448.76 g/mol. Its IUPAC name is methyl 20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoate.
| Compound Name | methyl 20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 85096383 |
| Molecular Formula | C27H48O3Si |
| Molecular Weight | 448.76 g/mol |
| Exact Mass | 448.34 |
| IUPAC Name | methyl 20-[tert-butyl(dimethyl)silyl]oxyicosa-5,8,11,14-tetraenoate |
| SMILES | COC(=O)CCCC=CCC=CCC=CCC=CCCCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H48O3Si/c1-27(2,3)31(5,6)30-25-23-21-19-17-15-13-11-9-7-8-10-12-14-16-18-20-22-24-26(28)29-4/h7,9-10,12-13,15-16,18H,8,11,14,17,19-25H2,1-6H3 |
| InChIKey | OINCWUJSLZOHRD-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.76 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|