C25H21ClF4N2O6 — CID 85097619
methyl 3-[2-(7-chloro-1-oxoisoquinolin-2-yl)butanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 85097619) has the molecular formula C25H21ClF4N2O6 and a molecular weight of 556.90 g/mol. Its IUPAC name is methyl 3-[2-(7-chloro-1-oxoisoquinolin-2-yl)butanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | methyl 3-[2-(7-chloro-1-oxoisoquinolin-2-yl)butanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 85097619 |
| Molecular Formula | C25H21ClF4N2O6 |
| Molecular Weight | 556.90 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | methyl 3-[2-(7-chloro-1-oxoisoquinolin-2-yl)butanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CCC(C(=O)NC(CC(=O)OC)C(=O)COc1c(F)c(F)cc(F)c1F)n1ccc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C25H21ClF4N2O6/c1-3-18(32-7-6-12-4-5-13(26)8-14(12)25(32)36)24(35)31-17(10-20(34)37-2)19(33)11-38-23-21(29)15(27)9-16(28)22(23)30/h4-9,17-18H,3,10-11H2,1-2H3,(H,31,35) |
| InChIKey | NFOPQYORFITMRG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|