About 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol
7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol (PubChem CID 85099612) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol.
Molecular Properties
| Compound Name | 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol |
| PubChem CID | 85099612 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol |
| SMILES | CC1(O)CC(O)c2ccncc21 |
| InChI | InChI=1S/C9H11NO2/c1-9(12)4-8(11)6-2-3-10-5-7(6)9/h2-3,5,8,11-12H,4H2,1H3 |
| InChIKey | DYWLKOLCHFNIMS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol?
The IUPAC name of 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol (CID 85099612) is 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol.
What is the SMILES notation for 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol?
The canonical SMILES for 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol is CC1(O)CC(O)c2ccncc21.
What is the InChIKey of 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol?
The InChIKey is DYWLKOLCHFNIMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-9(12)4-8(11)6-2-3-10-5-7(6)9/h2-3,5,8,11-12H,4H2,1H3.
What are the key properties of 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol?
7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol has a molecular weight of 165.19 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,6-dihydrocyclopenta[c]pyridine-5,7-diol is sourced from PubChem (CID 85099612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).