C12H8Cl2N2OS — CID 851058
(5Z)-5-[(2,6-dichlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one (PubChem CID 851058) has the molecular formula C12H8Cl2N2OS and a molecular weight of 299.18 g/mol. Its IUPAC name is (5Z)-5-[(2,6-dichlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one.
| Compound Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one |
|---|---|
| PubChem CID | 851058 |
| Molecular Formula | C12H8Cl2N2OS |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | (5Z)-5-[(2,6-dichlorophenyl)methylidene]-2,3-dihydroimidazo[2,1-b][1,3]thiazol-6-one |
| SMILES | O=C1N=C2SCCN2/C1=C\c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H8Cl2N2OS/c13-8-2-1-3-9(14)7(8)6-10-11(17)15-12-16(10)4-5-18-12/h1-3,6H,4-5H2/b10-6- |
| InChIKey | NGDAURFCZOIWTB-POHAHGRESA-N |
| XLogP | 3.28 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|