About 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one
5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one (PubChem CID 85108162) has the molecular formula C19H30O3
and a molecular weight of 306.45 g/mol. Its IUPAC name is 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one |
| PubChem CID | 85108162 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one |
| SMILES | CC=CCCCCCCCCC(=O)C1=C(C)CC(C)OC1=O |
| InChI | InChI=1S/C19H30O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h4-5,16H,6-14H2,1-3H3 |
| InChIKey | LDTOSUNDGREUIH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
The IUPAC name of 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one (CID 85108162) is 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one.
What is the SMILES notation for 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
The canonical SMILES for 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one is CC=CCCCCCCCCC(=O)C1=C(C)CC(C)OC1=O.
What is the InChIKey of 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
The InChIKey is LDTOSUNDGREUIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O3/c1-4-5-6-7-8-9-10-11-12-13-17(20)18-15(2)14-16(3)22-19(18)21/h4-5,16H,6-14H2,1-3H3.
What are the key properties of 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one?
5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one has a molecular weight of 306.45 g/mol, XLogP of 4.90, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-dodec-10-enoyl-2,4-dimethyl-2,3-dihydropyran-6-one is sourced from PubChem (CID 85108162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).