C21H29NOSi — CID 85108691
[2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanamine (PubChem CID 85108691) has the molecular formula C21H29NOSi and a molecular weight of 339.56 g/mol. Its IUPAC name is [2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanamine.
| Compound Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanamine |
|---|---|
| PubChem CID | 85108691 |
| Molecular Formula | C21H29NOSi |
| Molecular Weight | 339.56 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | [2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]methanamine |
| SMILES | CC(C)(C)[Si](OCC1CC1CN)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H29NOSi/c1-21(2,3)24(19-10-6-4-7-11-19,20-12-8-5-9-13-20)23-16-18-14-17(18)15-22/h4-13,17-18H,14-16,22H2,1-3H3 |
| InChIKey | NMFRBCLIERXFLE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|