C20H21ClN2O5 — CID 8511019
[2-oxo-2-(4-propoxycarbonylanilino)ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate (PubChem CID 8511019) has the molecular formula C20H21ClN2O5 and a molecular weight of 404.85 g/mol. Its IUPAC name is [2-oxo-2-(4-propoxycarbonylanilino)ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate.
| Compound Name | [2-oxo-2-(4-propoxycarbonylanilino)ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 8511019 |
| Molecular Formula | C20H21ClN2O5 |
| Molecular Weight | 404.85 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | [2-oxo-2-(4-propoxycarbonylanilino)ethyl] 2-chloro-4,6-dimethylpyridine-3-carboxylate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)COC(=O)c2c(C)cc(C)nc2Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O5/c1-4-9-27-19(25)14-5-7-15(8-6-14)23-16(24)11-28-20(26)17-12(2)10-13(3)22-18(17)21/h5-8,10H,4,9,11H2,1-3H3,(H,23,24) |
| InChIKey | YGKOBGPTKPBQHH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.85 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|