About 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile
2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile (PubChem CID 851112) has the molecular formula C19H20N2S
and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile |
| PubChem CID | 851112 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile |
| SMILES | CC1(C)CCc2nc(SCc3ccccc3)c(C#N)cc2C1 |
| InChI | InChI=1S/C19H20N2S/c1-19(2)9-8-17-15(11-19)10-16(12-20)18(21-17)22-13-14-6-4-3-5-7-14/h3-7,10H,8-9,11,13H2,1-2H3 |
| InChIKey | SEFWOOOGFLQWMC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile?
The IUPAC name of 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile (CID 851112) is 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile.
What is the SMILES notation for 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile?
The canonical SMILES for 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile is CC1(C)CCc2nc(SCc3ccccc3)c(C#N)cc2C1.
What is the InChIKey of 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile?
The InChIKey is SEFWOOOGFLQWMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2S/c1-19(2)9-8-17-15(11-19)10-16(12-20)18(21-17)22-13-14-6-4-3-5-7-14/h3-7,10H,8-9,11,13H2,1-2H3.
What are the key properties of 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile?
2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile has a molecular weight of 308.45 g/mol, XLogP of 4.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylsulfanyl-6,6-dimethyl-7,8-dihydro-5H-quinoline-3-carbonitrile is sourced from PubChem (CID 851112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).