About 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole
4,5-dihydrobenzo[e][1,2,3]benzothiadiazole (PubChem CID 851115) has the molecular formula C10H8N2S
and a molecular weight of 188.26 g/mol. Its IUPAC name is 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole.
Molecular Properties
| Compound Name | 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole |
| PubChem CID | 851115 |
| Molecular Formula | C10H8N2S |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole |
| SMILES | c1ccc2c(c1)CCc1snnc1-2 |
| InChI | InChI=1S/C10H8N2S/c1-2-4-8-7(3-1)5-6-9-10(8)11-12-13-9/h1-4H,5-6H2 |
| InChIKey | LDRNYXFIZRDPJG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole?
The IUPAC name of 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole (CID 851115) is 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole.
What is the SMILES notation for 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole?
The canonical SMILES for 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole is c1ccc2c(c1)CCc1snnc1-2.
What is the InChIKey of 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole?
The InChIKey is LDRNYXFIZRDPJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S/c1-2-4-8-7(3-1)5-6-9-10(8)11-12-13-9/h1-4H,5-6H2.
What are the key properties of 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole?
4,5-dihydrobenzo[e][1,2,3]benzothiadiazole has a molecular weight of 188.26 g/mol, XLogP of 2.30, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydrobenzo[e][1,2,3]benzothiadiazole is sourced from PubChem (CID 851115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).