About 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde
6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde (PubChem CID 85114857) has the molecular formula C21H38O3Si
and a molecular weight of 366.62 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde.
Molecular Properties
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde |
| PubChem CID | 85114857 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde |
| SMILES | CCCCCCCC1=C(C=O)C(C=O)C(O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H38O3Si/c1-7-8-9-10-11-12-17-13-14-20(19(16-23)18(17)15-22)24-25(5,6)21(2,3)4/h15-16,19-20H,7-14H2,1-6H3 |
| InChIKey | LGVBPVPUJWXCPH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde?
The IUPAC name of 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde (CID 85114857) is 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde.
What is the SMILES notation for 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde?
The canonical SMILES for 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde is CCCCCCCC1=C(C=O)C(C=O)C(O[Si](C)(C)C(C)(C)C)CC1.
What is the InChIKey of 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde?
The InChIKey is LGVBPVPUJWXCPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O3Si/c1-7-8-9-10-11-12-17-13-14-20(19(16-23)18(17)15-22)24-25(5,6)21(2,3)4/h15-16,19-20H,7-14H2,1-6H3.
What are the key properties of 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde?
6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde has a molecular weight of 366.62 g/mol, XLogP of 5.84, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[tert-butyl(dimethyl)silyl]oxy-3-heptylcyclohex-2-ene-1,2-dicarbaldehyde is sourced from PubChem (CID 85114857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).