About 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide
4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide (PubChem CID 851155) has the molecular formula C13H14N4O3
and a molecular weight of 274.28 g/mol. Its IUPAC name is 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide.
Molecular Properties
| Compound Name | 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide |
| PubChem CID | 851155 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide |
| SMILES | CNC(=O)c1[nH]cnc1C(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C13H14N4O3/c1-14-12(18)10-11(16-7-15-10)13(19)17-8-5-3-4-6-9(8)20-2/h3-7H,1-2H3,(H,14,18)(H,15,16)(H,17,19) |
| InChIKey | ZCXIITLBXZWRPW-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide?
The IUPAC name of 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide (CID 851155) is 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide.
What is the SMILES notation for 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide?
The canonical SMILES for 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide is CNC(=O)c1[nH]cnc1C(=O)Nc1ccccc1OC.
What is the InChIKey of 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide?
The InChIKey is ZCXIITLBXZWRPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O3/c1-14-12(18)10-11(16-7-15-10)13(19)17-8-5-3-4-6-9(8)20-2/h3-7H,1-2H3,(H,14,18)(H,15,16)(H,17,19).
What are the key properties of 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide?
4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide has a molecular weight of 274.28 g/mol, XLogP of 1.03, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-(2-methoxyphenyl)-5-N-methyl-1H-imidazole-4,5-dicarboxamide is sourced from PubChem (CID 851155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).