C42H72O12 — CID 85118232
3,15,16,18,20,21-hexahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one (PubChem CID 85118232) has the molecular formula C42H72O12 and a molecular weight of 769.03 g/mol. Its IUPAC name is 3,15,16,18,20,21-hexahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one.
| Compound Name | 3,15,16,18,20,21-hexahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one |
|---|---|
| PubChem CID | 85118232 |
| Molecular Formula | C42H72O12 |
| Molecular Weight | 769.03 g/mol |
| Exact Mass | 768.50 |
| IUPAC Name | 3,15,16,18,20,21-hexahydroxy-6'-(2-hydroxybutyl)-5,5,5',15,19,21,30-heptamethylspiro[4,25,29-trioxatricyclo[24.3.1.03,7]triaconta-8,22-diene-28,2'-oxane]-24-one |
| SMILES | CCC(O)CC1OC2(CCC1C)CC1OC(=O)C=CC(C)(O)C(O)C(C)C(O)CC(O)C(C)(O)CCCCCC=CC3CC(C)(C)OC3(O)CC(O2)C1C |
| InChI | InChI=1S/C42H72O12/c1-9-30(43)21-32-26(2)16-20-41(52-32)24-33-28(4)34(53-41)25-42(50)29(23-38(5,6)54-42)15-13-11-10-12-14-18-39(7,48)35(45)22-31(44)27(3)37(47)40(8,49)19-17-36(46)51-33/h13,15,17,19,26-35,37,43-45,47-50H,9-12,14,16,18,20-25H2,1-8H3 |
| InChIKey | ISPDBGRYUFZEAU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 195.60 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.03 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|