C8H13NO — CID 85125732
1,2,3,5,8,8a-hexahydroindolizin-8-ol (PubChem CID 85125732) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 1,2,3,5,8,8a-hexahydroindolizin-8-ol.
| Compound Name | 1,2,3,5,8,8a-hexahydroindolizin-8-ol |
|---|---|
| PubChem CID | 85125732 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1,2,3,5,8,8a-hexahydroindolizin-8-ol |
| SMILES | OC1C=CCN2CCCC12 |
| InChI | InChI=1S/C8H13NO/c10-8-4-2-6-9-5-1-3-7(8)9/h2,4,7-8,10H,1,3,5-6H2 |
| InChIKey | OEDHIYFLMVDBFV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|