About tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate
tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate (PubChem CID 85126541) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate |
| PubChem CID | 85126541 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate |
| SMILES | CCC(=O)C1=CCC2C=CC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21NO3/c1-5-13(17)11-8-6-10-7-9-12(11)16(10)14(18)19-15(2,3)4/h7-10,12H,5-6H2,1-4H3 |
| InChIKey | ALZFJRUQHJEDIV-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate?
The IUPAC name of tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate (CID 85126541) is tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate.
What is the SMILES notation for tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate?
The canonical SMILES for tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate is CCC(=O)C1=CCC2C=CC1N2C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate?
The InChIKey is ALZFJRUQHJEDIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-5-13(17)11-8-6-10-7-9-12(11)16(10)14(18)19-15(2,3)4/h7-10,12H,5-6H2,1-4H3.
What are the key properties of tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate?
tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate has a molecular weight of 263.34 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-propanoyl-8-azabicyclo[3.2.1]octa-2,6-diene-8-carboxylate is sourced from PubChem (CID 85126541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).