C17H20O5 — CID 85127063
4,7,8-trihydroxy-1,1,4a-trimethyl-2,4,10,10a-tetrahydrophenanthrene-3,9-dione (PubChem CID 85127063) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 4,7,8-trihydroxy-1,1,4a-trimethyl-2,4,10,10a-tetrahydrophenanthrene-3,9-dione.
| Compound Name | 4,7,8-trihydroxy-1,1,4a-trimethyl-2,4,10,10a-tetrahydrophenanthrene-3,9-dione |
|---|---|
| PubChem CID | 85127063 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4,7,8-trihydroxy-1,1,4a-trimethyl-2,4,10,10a-tetrahydrophenanthrene-3,9-dione |
| SMILES | CC1(C)CC(=O)C(O)C2(C)c3ccc(O)c(O)c3C(=O)CC12 |
| InChI | InChI=1S/C17H20O5/c1-16(2)7-11(20)15(22)17(3)8-4-5-9(18)14(21)13(8)10(19)6-12(16)17/h4-5,12,15,18,21-22H,6-7H2,1-3H3 |
| InChIKey | LAMDFUJULSOZET-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|