C18H26ClN3O3S — CID 8512767
(2S)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-cyclopentylpropanamide (PubChem CID 8512767) has the molecular formula C18H26ClN3O3S and a molecular weight of 399.94 g/mol. Its IUPAC name is (2S)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-cyclopentylpropanamide.
| Compound Name | (2S)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-cyclopentylpropanamide |
|---|---|
| PubChem CID | 8512767 |
| Molecular Formula | C18H26ClN3O3S |
| Molecular Weight | 399.94 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (2S)-2-[4-(3-chlorophenyl)sulfonylpiperazin-1-yl]-N-cyclopentylpropanamide |
| SMILES | C[C@@H](C(=O)NC1CCCC1)N1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H26ClN3O3S/c1-14(18(23)20-16-6-2-3-7-16)21-9-11-22(12-10-21)26(24,25)17-8-4-5-15(19)13-17/h4-5,8,13-14,16H,2-3,6-7,9-12H2,1H3,(H,20,23)/t14-/m0/s1 |
| InChIKey | RZMUICMATBRFAP-AWEZNQCLSA-N |
| XLogP | 2.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.94 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |